About [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene
[(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene (PubChem CID 15807298) has the molecular formula C19H24OSSe
and a molecular weight of 379.43 g/mol. Its IUPAC name is [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene.
Molecular Properties
| Compound Name | [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene |
| PubChem CID | 15807298 |
| Molecular Formula | C19H24OSSe |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene |
| SMILES | C[C@@H](C([Se]c1ccccc1)S(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H24OSSe/c1-15(19(2,3)4)18(22-17-13-9-6-10-14-17)21(20)16-11-7-5-8-12-16/h5-15,18H,1-4H3/t15-,18?,21?/m0/s1 |
| InChIKey | UFYJLRHVCVBMGZ-SBGRQLAYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene?
The IUPAC name of [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene (CID 15807298) is [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene.
What is the SMILES notation for [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene?
The canonical SMILES for [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene is C[C@@H](C([Se]c1ccccc1)S(=O)c1ccccc1)C(C)(C)C.
What is the InChIKey of [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene?
The InChIKey is UFYJLRHVCVBMGZ-SBGRQLAYSA-N. The full InChI is InChI=1S/C19H24OSSe/c1-15(19(2,3)4)18(22-17-13-9-6-10-14-17)21(20)16-11-7-5-8-12-16/h5-15,18H,1-4H3/t15-,18?,21?/m0/s1.
What are the key properties of [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene?
[(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene has a molecular weight of 379.43 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3,3-trimethyl-1-phenylselanylbutyl]sulfinylbenzene is sourced from PubChem (CID 15807298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).