About (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane
(4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane (PubChem CID 158073296) has the molecular formula C7H13N2W-
and a molecular weight of 309.04 g/mol. Its IUPAC name is (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane.
Molecular Properties
| Compound Name | (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane |
| PubChem CID | 158073296 |
| Molecular Formula | C7H13N2W- |
| Molecular Weight | 309.04 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane |
| SMILES | CCC.[N-]=C(N)C=CC=[W] |
| InChI | InChI=1S/C4H5N2.C3H8.W/c1-2-3-4(5)6;1-3-2;/h1-3H,(H2-,5,6);3H2,1-2H3;/q-1;; |
| InChIKey | OZXTVCNSJGTDIX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 48.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.04 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane?
The IUPAC name of (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane (CID 158073296) is (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane.
What is the SMILES notation for (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane?
The canonical SMILES for (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane is CCC.[N-]=C(N)C=CC=[W].
What is the InChIKey of (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane?
The InChIKey is OZXTVCNSJGTDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N2.C3H8.W/c1-2-3-4(5)6;1-3-2;/h1-3H,(H2-,5,6);3H2,1-2H3;/q-1;;.
What are the key properties of (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane?
(4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane has a molecular weight of 309.04 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-azanidylidenebut-2-enylidene)tungsten;propane is sourced from PubChem (CID 158073296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).