About tert-butyl formate;(2S)-2-methylpiperazine
tert-butyl formate;(2S)-2-methylpiperazine (PubChem CID 158074462) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is tert-butyl formate;(2S)-2-methylpiperazine.
Molecular Properties
| Compound Name | tert-butyl formate;(2S)-2-methylpiperazine |
| PubChem CID | 158074462 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | tert-butyl formate;(2S)-2-methylpiperazine |
| SMILES | CC(C)(C)OC=O.C[C@H]1CNCCN1 |
| InChI | InChI=1S/C5H12N2.C5H10O2/c1-5-4-6-2-3-7-5;1-5(2,3)7-4-6/h5-7H,2-4H2,1H3;4H,1-3H3/t5-;/m0./s1 |
| InChIKey | FMEVUHKGNZCSQF-JEDNCBNOSA-N |
| XLogP | 0.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;(2S)-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;(2S)-2-methylpiperazine?
The IUPAC name of tert-butyl formate;(2S)-2-methylpiperazine (CID 158074462) is tert-butyl formate;(2S)-2-methylpiperazine.
What is the SMILES notation for tert-butyl formate;(2S)-2-methylpiperazine?
The canonical SMILES for tert-butyl formate;(2S)-2-methylpiperazine is CC(C)(C)OC=O.C[C@H]1CNCCN1.
What is the InChIKey of tert-butyl formate;(2S)-2-methylpiperazine?
The InChIKey is FMEVUHKGNZCSQF-JEDNCBNOSA-N. The full InChI is InChI=1S/C5H12N2.C5H10O2/c1-5-4-6-2-3-7-5;1-5(2,3)7-4-6/h5-7H,2-4H2,1H3;4H,1-3H3/t5-;/m0./s1.
What are the key properties of tert-butyl formate;(2S)-2-methylpiperazine?
tert-butyl formate;(2S)-2-methylpiperazine has a molecular weight of 202.30 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;(2S)-2-methylpiperazine is sourced from PubChem (CID 158074462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).