About N-ethenyl-2-methylpropanamide;2-methylpropanamide
N-ethenyl-2-methylpropanamide;2-methylpropanamide (PubChem CID 158076450) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-ethenyl-2-methylpropanamide;2-methylpropanamide.
Molecular Properties
| Compound Name | N-ethenyl-2-methylpropanamide;2-methylpropanamide |
| PubChem CID | 158076450 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-ethenyl-2-methylpropanamide;2-methylpropanamide |
| SMILES | C=CNC(=O)C(C)C.CC(C)C(N)=O |
| InChI | InChI=1S/C6H11NO.C4H9NO/c1-4-7-6(8)5(2)3;1-3(2)4(5)6/h4-5H,1H2,2-3H3,(H,7,8);3H,1-2H3,(H2,5,6) |
| InChIKey | FMKUUTFDAPLLIH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethenyl-2-methylpropanamide;2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-methylpropanamide;2-methylpropanamide?
The IUPAC name of N-ethenyl-2-methylpropanamide;2-methylpropanamide (CID 158076450) is N-ethenyl-2-methylpropanamide;2-methylpropanamide.
What is the SMILES notation for N-ethenyl-2-methylpropanamide;2-methylpropanamide?
The canonical SMILES for N-ethenyl-2-methylpropanamide;2-methylpropanamide is C=CNC(=O)C(C)C.CC(C)C(N)=O.
What is the InChIKey of N-ethenyl-2-methylpropanamide;2-methylpropanamide?
The InChIKey is FMKUUTFDAPLLIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H9NO/c1-4-7-6(8)5(2)3;1-3(2)4(5)6/h4-5H,1H2,2-3H3,(H,7,8);3H,1-2H3,(H2,5,6).
What are the key properties of N-ethenyl-2-methylpropanamide;2-methylpropanamide?
N-ethenyl-2-methylpropanamide;2-methylpropanamide has a molecular weight of 200.28 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-methylpropanamide;2-methylpropanamide is sourced from PubChem (CID 158076450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).