C11H14O3 — CID 15807648
methyl (4R,5S,6R,9S)-9-hydroxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate (PubChem CID 15807648) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl (4R,5S,6R,9S)-9-hydroxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate.
| Compound Name | methyl (4R,5S,6R,9S)-9-hydroxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate |
|---|---|
| PubChem CID | 15807648 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methyl (4R,5S,6R,9S)-9-hydroxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=CC23[C@@H]1CC[C@@H]3O |
| InChI | InChI=1S/C11H14O3/c1-14-10(13)9-6-2-3-8(12)11(6)5-4-7(9)11/h4-9,12H,2-3H2,1H3/t6-,7-,8+,9+,11?/m1/s1 |
| InChIKey | AEFJPFFNEYRBNK-MGFGZQEKSA-N |
| XLogP | 0.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|