C29H39NO2S3 — CID 158076544
2,4-dimethylfuran;2,5-dimethylfuran;2,5-dimethyl-1,3-thiazole;2,4-dimethylthiophene;2,5-dimethylthiophene (PubChem CID 158076544) has the molecular formula C29H39NO2S3 and a molecular weight of 529.84 g/mol. Its IUPAC name is 2,4-dimethylfuran;2,5-dimethylfuran;2,5-dimethyl-1,3-thiazole;2,4-dimethylthiophene;2,5-dimethylthiophene.
| Compound Name | 2,4-dimethylfuran;2,5-dimethylfuran;2,5-dimethyl-1,3-thiazole;2,4-dimethylthiophene;2,5-dimethylthiophene |
|---|---|
| PubChem CID | 158076544 |
| Molecular Formula | C29H39NO2S3 |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2,4-dimethylfuran;2,5-dimethylfuran;2,5-dimethyl-1,3-thiazole;2,4-dimethylthiophene;2,5-dimethylthiophene |
| SMILES | Cc1ccc(C)o1.Cc1ccc(C)s1.Cc1cnc(C)s1.Cc1coc(C)c1.Cc1csc(C)c1 |
| InChI | InChI=1S/2C6H8O.2C6H8S.C5H7NS/c1-5-3-6(2)7-4-5;1-5-3-4-6(2)7-5;1-5-3-6(2)7-4-5;1-5-3-4-6(2)7-5;1-4-3-6-5(2)7-4/h4*3-4H,1-2H3;3H,1-2H3 |
| InChIKey | FMLCAKYAYPTBAC-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |