About thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one
thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one (PubChem CID 158077280) has the molecular formula C14H13NO2S2
and a molecular weight of 291.40 g/mol. Its IUPAC name is thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one.
Molecular Properties
| Compound Name | thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one |
| PubChem CID | 158077280 |
| Molecular Formula | C14H13NO2S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one |
| SMILES | O=C1C=CN(c2ccsc2)CC1.O=Cc1ccsc1 |
| InChI | InChI=1S/C9H9NOS.C5H4OS/c11-9-1-4-10(5-2-9)8-3-6-12-7-8;6-3-5-1-2-7-4-5/h1,3-4,6-7H,2,5H2;1-4H |
| InChIKey | FMNIBZHXSZPXSB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one?
The IUPAC name of thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one (CID 158077280) is thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one.
What is the SMILES notation for thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one?
The canonical SMILES for thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one is O=C1C=CN(c2ccsc2)CC1.O=Cc1ccsc1.
What is the InChIKey of thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one?
The InChIKey is FMNIBZHXSZPXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS.C5H4OS/c11-9-1-4-10(5-2-9)8-3-6-12-7-8;6-3-5-1-2-7-4-5/h1,3-4,6-7H,2,5H2;1-4H.
What are the key properties of thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one?
thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one has a molecular weight of 291.40 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-3-carbaldehyde;1-thiophen-3-yl-2,3-dihydropyridin-4-one is sourced from PubChem (CID 158077280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).