C85H124BN8O21 — CID 158078341
CID 158078341 (PubChem CID 158078341) has the molecular formula C85H124BN8O21 and a molecular weight of 1604.77 g/mol.
| Compound Name | CID 158078341 |
|---|---|
| PubChem CID | 158078341 |
| Molecular Formula | C85H124BN8O21 |
| Molecular Weight | 1604.77 g/mol |
| Exact Mass | 1603.90 |
| IUPAC Name | — |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(CCCCn3cnc(-c4ccc(C)nc4)c3)C(=O)O[C@]12C.CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2OC(=O)c2ccccc2)[C@@](C)(OC)C[C@@H](C)C(=O)/C(C)=C/[C@]1(C)OC(=O)n1ccnc1.[B] |
| InChI | InChI=1S/C44H67N5O10.C41H57N3O11.B/c1-13-34-44(9)38(49(42(54)59-44)19-15-14-18-48-23-32(46-24-48)31-17-16-26(3)45-22-31)28(5)35(50)25(2)21-43(8,55-12)39(29(6)36(51)30(7)40(53)57-34)58-41-37(52)33(47(10)11)20-27(4)56-41;1-12-31-40(7,55-39(49)44-19-18-42-23-44)21-24(2)32(45)25(3)22-41(8,50-11)35(27(5)33(46)28(6)36(47)52-31)54-38-34(30(43(9)10)20-26(4)51-38)53-37(48)29-16-14-13-15-17-29;/h16-17,22-25,27-30,33-34,37-39,41,52H,13-15,18-21H2,1-12H3;13-19,21,23,25-28,30-31,34-35,38H,12,20,22H2,1-11H3;/b;24-21+;/t25-,27-,28+,29+,30-,33+,34-,37-,38-,39-,41+,43+,44-;25-,26-,27+,28-,30+,31-,34-,35-,38+,40+,41+;/m11./s1 |
| InChIKey | PNIPRGFNRSYIHT-NSBOYCOFSA-N |
| XLogP | 10.28 |
| TPSA | 333.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 115 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1604.77 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|