About propyl carbamodithioate;1H-pyrimidine-2,4-dione
propyl carbamodithioate;1H-pyrimidine-2,4-dione (PubChem CID 158079021) has the molecular formula C8H13N3O2S2
and a molecular weight of 247.34 g/mol. Its IUPAC name is propyl carbamodithioate;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | propyl carbamodithioate;1H-pyrimidine-2,4-dione |
| PubChem CID | 158079021 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | propyl carbamodithioate;1H-pyrimidine-2,4-dione |
| SMILES | CCCSC(N)=S.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C4H9NS2/c7-3-1-2-5-4(8)6-3;1-2-3-7-4(5)6/h1-2H,(H2,5,6,7,8);2-3H2,1H3,(H2,5,6) |
| InChIKey | FMSKLWCWKAZHJC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propyl carbamodithioate;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl carbamodithioate;1H-pyrimidine-2,4-dione?
The IUPAC name of propyl carbamodithioate;1H-pyrimidine-2,4-dione (CID 158079021) is propyl carbamodithioate;1H-pyrimidine-2,4-dione.
What is the SMILES notation for propyl carbamodithioate;1H-pyrimidine-2,4-dione?
The canonical SMILES for propyl carbamodithioate;1H-pyrimidine-2,4-dione is CCCSC(N)=S.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of propyl carbamodithioate;1H-pyrimidine-2,4-dione?
The InChIKey is FMSKLWCWKAZHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C4H9NS2/c7-3-1-2-5-4(8)6-3;1-2-3-7-4(5)6/h1-2H,(H2,5,6,7,8);2-3H2,1H3,(H2,5,6).
What are the key properties of propyl carbamodithioate;1H-pyrimidine-2,4-dione?
propyl carbamodithioate;1H-pyrimidine-2,4-dione has a molecular weight of 247.34 g/mol, XLogP of 0.44, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl carbamodithioate;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 158079021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).