C18H27F3O13 — CID 158079219
(6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane (PubChem CID 158079219) has the molecular formula C18H27F3O13 and a molecular weight of 508.40 g/mol. Its IUPAC name is (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane.
| Compound Name | (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
|---|---|
| PubChem CID | 158079219 |
| Molecular Formula | C18H27F3O13 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylic acid;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
| SMILES | COC(C)(OC)OC.COC1(C)OC2C3O[C@@H](C(C(=O)O)C3C(=O)O)[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H14O8.C5H12O3.C2HF3O2/c1-11(16-2)18-7-5-3(9(12)13)4(10(14)15)6(17-5)8(7)19-11;1-5(6-2,7-3)8-4;3-2(4,5)1(6)7/h3-8H,1-2H3,(H,12,13)(H,14,15);1-4H3;(H,6,7)/t3?,4?,5-,6?,7+,8?,11?;;/m0../s1 |
| InChIKey | PDKJOTWVPOGKTG-LOVHIXOBSA-N |
| XLogP | 0.51 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|