About [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol
[2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol (PubChem CID 15807945) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol |
| PubChem CID | 15807945 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol |
| SMILES | CN[C@@H]1Cc2ccccc2[C@H]1Nc1ccccc1CO |
| InChI | InChI=1S/C17H20N2O/c1-18-16-10-12-6-2-4-8-14(12)17(16)19-15-9-5-3-7-13(15)11-20/h2-9,16-20H,10-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | OCGLHLMTOGXQRS-IAGOWNOFSA-N |
| XLogP | 2.48 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol?
The IUPAC name of [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol (CID 15807945) is [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol.
What is the SMILES notation for [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol?
The canonical SMILES for [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol is CN[C@@H]1Cc2ccccc2[C@H]1Nc1ccccc1CO.
What is the InChIKey of [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol?
The InChIKey is OCGLHLMTOGXQRS-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H20N2O/c1-18-16-10-12-6-2-4-8-14(12)17(16)19-15-9-5-3-7-13(15)11-20/h2-9,16-20H,10-11H2,1H3/t16-,17-/m1/s1.
What are the key properties of [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol?
[2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol has a molecular weight of 268.36 g/mol, XLogP of 2.48, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(1R,2R)-2-(methylamino)-2,3-dihydro-1H-inden-1-yl]amino]phenyl]methanol is sourced from PubChem (CID 15807945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).