About 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine
1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine (PubChem CID 158079923) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine |
| PubChem CID | 158079923 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine |
| SMILES | CC1CC(=O)N(C)C1=O.CNN=C(C)C |
| InChI | InChI=1S/C6H9NO2.C4H10N2/c1-4-3-5(8)7(2)6(4)9;1-4(2)6-5-3/h4H,3H2,1-2H3;5H,1-3H3 |
| InChIKey | FMVCZBASYAXYNE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine?
The IUPAC name of 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine (CID 158079923) is 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine.
What is the SMILES notation for 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine?
The canonical SMILES for 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine is CC1CC(=O)N(C)C1=O.CNN=C(C)C.
What is the InChIKey of 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine?
The InChIKey is FMVCZBASYAXYNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C4H10N2/c1-4-3-5(8)7(2)6(4)9;1-4(2)6-5-3/h4H,3H2,1-2H3;5H,1-3H3.
What are the key properties of 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine?
1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine has a molecular weight of 213.28 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidine-2,5-dione;N-(propan-2-ylideneamino)methanamine is sourced from PubChem (CID 158079923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).