About 2,4-di(butan-2-yl)phenol
2,4-di(butan-2-yl)phenol (PubChem CID 15808) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,4-di(butan-2-yl)phenol.
Molecular Properties
| Compound Name | 2,4-di(butan-2-yl)phenol |
| PubChem CID | 15808 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2,4-di(butan-2-yl)phenol |
| SMILES | CCC(C)c1ccc(O)c(C(C)CC)c1 |
| InChI | InChI=1S/C14H22O/c1-5-10(3)12-7-8-14(15)13(9-12)11(4)6-2/h7-11,15H,5-6H2,1-4H3 |
| InChIKey | JERZAOOJWPHIDG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-di(butan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-di(butan-2-yl)phenol?
The IUPAC name of 2,4-di(butan-2-yl)phenol (CID 15808) is 2,4-di(butan-2-yl)phenol.
What is the SMILES notation for 2,4-di(butan-2-yl)phenol?
The canonical SMILES for 2,4-di(butan-2-yl)phenol is CCC(C)c1ccc(O)c(C(C)CC)c1.
What is the InChIKey of 2,4-di(butan-2-yl)phenol?
The InChIKey is JERZAOOJWPHIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-5-10(3)12-7-8-14(15)13(9-12)11(4)6-2/h7-11,15H,5-6H2,1-4H3.
What are the key properties of 2,4-di(butan-2-yl)phenol?
2,4-di(butan-2-yl)phenol has a molecular weight of 206.33 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-di(butan-2-yl)phenol is sourced from PubChem (CID 15808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).