C14H10F6S2 — CID 158080400
methane;1,2,3,4,5-pentafluoro-6-[(4-fluorophenyl)sulfanylmethylsulfanyl]benzene (PubChem CID 158080400) has the molecular formula C14H10F6S2 and a molecular weight of 356.36 g/mol. Its IUPAC name is methane;1,2,3,4,5-pentafluoro-6-[(4-fluorophenyl)sulfanylmethylsulfanyl]benzene.
| Compound Name | methane;1,2,3,4,5-pentafluoro-6-[(4-fluorophenyl)sulfanylmethylsulfanyl]benzene |
|---|---|
| PubChem CID | 158080400 |
| Molecular Formula | C14H10F6S2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | methane;1,2,3,4,5-pentafluoro-6-[(4-fluorophenyl)sulfanylmethylsulfanyl]benzene |
| SMILES | C.Fc1ccc(SCSc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H6F6S2.CH4/c14-6-1-3-7(4-2-6)20-5-21-13-11(18)9(16)8(15)10(17)12(13)19;/h1-4H,5H2;1H4 |
| InChIKey | FMWPIDRNIDEAMT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|