C31H41F2NO3S — CID 158080506
1-[3-[3-(10,10-difluorodecoxy)phenyl]sulfonylphenyl]-4-methyl-2,3,3a,4,5,6-hexahydroindole (PubChem CID 158080506) has the molecular formula C31H41F2NO3S and a molecular weight of 545.74 g/mol. Its IUPAC name is 1-[3-[3-(10,10-difluorodecoxy)phenyl]sulfonylphenyl]-4-methyl-2,3,3a,4,5,6-hexahydroindole.
| Compound Name | 1-[3-[3-(10,10-difluorodecoxy)phenyl]sulfonylphenyl]-4-methyl-2,3,3a,4,5,6-hexahydroindole |
|---|---|
| PubChem CID | 158080506 |
| Molecular Formula | C31H41F2NO3S |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 1-[3-[3-(10,10-difluorodecoxy)phenyl]sulfonylphenyl]-4-methyl-2,3,3a,4,5,6-hexahydroindole |
| SMILES | CC1CCC=C2C1CCN2c1cccc(S(=O)(=O)c2cccc(OCCCCCCCCCC(F)F)c2)c1 |
| InChI | InChI=1S/C31H41F2NO3S/c1-24-12-9-17-30-29(24)19-20-34(30)25-13-10-15-27(22-25)38(35,36)28-16-11-14-26(23-28)37-21-8-6-4-2-3-5-7-18-31(32)33/h10-11,13-17,22-24,29,31H,2-9,12,18-21H2,1H3 |
| InChIKey | DSYTVRXABPQWIU-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|