About 7-bromo-1H-indole;7-bromo-1-methylindole
7-bromo-1H-indole;7-bromo-1-methylindole (PubChem CID 158081765) has the molecular formula C17H14Br2N2
and a molecular weight of 406.12 g/mol. Its IUPAC name is 7-bromo-1H-indole;7-bromo-1-methylindole.
Molecular Properties
| Compound Name | 7-bromo-1H-indole;7-bromo-1-methylindole |
| PubChem CID | 158081765 |
| Molecular Formula | C17H14Br2N2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 7-bromo-1H-indole;7-bromo-1-methylindole |
| SMILES | Brc1cccc2cc[nH]c12.Cn1ccc2cccc(Br)c21 |
| InChI | InChI=1S/C9H8BrN.C8H6BrN/c1-11-6-5-7-3-2-4-8(10)9(7)11;9-7-3-1-2-6-4-5-10-8(6)7/h2-6H,1H3;1-5,10H |
| InChIKey | FNAQNZHENLAJFA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1H-indole;7-bromo-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1H-indole;7-bromo-1-methylindole?
The IUPAC name of 7-bromo-1H-indole;7-bromo-1-methylindole (CID 158081765) is 7-bromo-1H-indole;7-bromo-1-methylindole.
What is the SMILES notation for 7-bromo-1H-indole;7-bromo-1-methylindole?
The canonical SMILES for 7-bromo-1H-indole;7-bromo-1-methylindole is Brc1cccc2cc[nH]c12.Cn1ccc2cccc(Br)c21.
What is the InChIKey of 7-bromo-1H-indole;7-bromo-1-methylindole?
The InChIKey is FNAQNZHENLAJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN.C8H6BrN/c1-11-6-5-7-3-2-4-8(10)9(7)11;9-7-3-1-2-6-4-5-10-8(6)7/h2-6H,1H3;1-5,10H.
What are the key properties of 7-bromo-1H-indole;7-bromo-1-methylindole?
7-bromo-1H-indole;7-bromo-1-methylindole has a molecular weight of 406.12 g/mol, XLogP of 5.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1H-indole;7-bromo-1-methylindole is sourced from PubChem (CID 158081765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).