C15H15NO5 — CID 15808182
dimethyl (1R,2R,3R,6S,7R,8S,9R,12S)-5-oxo-4-azapentacyclo[6.4.0.02,7.03,6.09,12]dodec-10-ene-1,8-dicarboxylate (PubChem CID 15808182) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is dimethyl (1R,2R,3R,6S,7R,8S,9R,12S)-5-oxo-4-azapentacyclo[6.4.0.02,7.03,6.09,12]dodec-10-ene-1,8-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3R,6S,7R,8S,9R,12S)-5-oxo-4-azapentacyclo[6.4.0.02,7.03,6.09,12]dodec-10-ene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 15808182 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | dimethyl (1R,2R,3R,6S,7R,8S,9R,12S)-5-oxo-4-azapentacyclo[6.4.0.02,7.03,6.09,12]dodec-10-ene-1,8-dicarboxylate |
| SMILES | COC(=O)[C@@]12[C@H]3[C@@H]4C(=O)N[C@@H]4[C@H]3[C@]1(C(=O)OC)[C@H]1C=C[C@H]12 |
| InChI | InChI=1S/C15H15NO5/c1-20-12(18)14-5-3-4-6(5)15(14,13(19)21-2)9-8(14)7-10(9)16-11(7)17/h3-10H,1-2H3,(H,16,17)/t5-,6+,7+,8+,9+,10+,14-,15+/m1/s1 |
| InChIKey | PCPREXIHBOMDOC-KINCQHMNSA-N |
| XLogP | -0.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|