C49H38BBr2N5O2 — CID 158081866
2,5-dibromo-4-(2-methylpropyl)pyridine;[11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenyl-11H-indeno[1,2-b]carbazol-9-yl]boronic acid (PubChem CID 158081866) has the molecular formula C49H38BBr2N5O2 and a molecular weight of 899.50 g/mol. Its IUPAC name is 2,5-dibromo-4-(2-methylpropyl)pyridine;[11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenyl-11H-indeno[1,2-b]carbazol-9-yl]boronic acid.
| Compound Name | 2,5-dibromo-4-(2-methylpropyl)pyridine;[11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenyl-11H-indeno[1,2-b]carbazol-9-yl]boronic acid |
|---|---|
| PubChem CID | 158081866 |
| Molecular Formula | C49H38BBr2N5O2 |
| Molecular Weight | 899.50 g/mol |
| Exact Mass | 897.15 |
| IUPAC Name | 2,5-dibromo-4-(2-methylpropyl)pyridine;[11-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenyl-11H-indeno[1,2-b]carbazol-9-yl]boronic acid |
| SMILES | CC(C)Cc1cc(Br)ncc1Br.OB(O)c1ccc2c(c1)C(c1nc(-c3ccccc3)nc(-c3ccccc3)n1)c1cc3c4ccccc4n(-c4ccccc4)c3cc1-2 |
| InChI | InChI=1S/C40H27BN4O2.C9H11Br2N/c46-41(47)27-20-21-29-31-24-36-32(30-18-10-11-19-35(30)45(36)28-16-8-3-9-17-28)23-34(31)37(33(29)22-27)40-43-38(25-12-4-1-5-13-25)42-39(44-40)26-14-6-2-7-15-26;1-6(2)3-7-4-9(11)12-5-8(7)10/h1-24,37,46-47H;4-6H,3H2,1-2H3 |
| InChIKey | FNBAGFPJMYGYFG-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.50 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|