C11H19NO2S2 — CID 158082275
(4R)-N,N,7,7-tetramethyl-6-oxodithiocane-4-carboxamide (PubChem CID 158082275) has the molecular formula C11H19NO2S2 and a molecular weight of 261.41 g/mol. Its IUPAC name is (4R)-N,N,7,7-tetramethyl-6-oxodithiocane-4-carboxamide.
| Compound Name | (4R)-N,N,7,7-tetramethyl-6-oxodithiocane-4-carboxamide |
|---|---|
| PubChem CID | 158082275 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (4R)-N,N,7,7-tetramethyl-6-oxodithiocane-4-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CSSCC(C)(C)C(=O)C1 |
| InChI | InChI=1S/C11H19NO2S2/c1-11(2)7-16-15-6-8(5-9(11)13)10(14)12(3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | FNCGFQNOHGIEGD-QMMMGPOBSA-N |
| XLogP | 2.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|