C22H18F2N2O2 — CID 15808261
7-(diethylamino)-1,4-difluoro-2-phenylphenoxazin-3-one (PubChem CID 15808261) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is 7-(diethylamino)-1,4-difluoro-2-phenylphenoxazin-3-one.
| Compound Name | 7-(diethylamino)-1,4-difluoro-2-phenylphenoxazin-3-one |
|---|---|
| PubChem CID | 15808261 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 7-(diethylamino)-1,4-difluoro-2-phenylphenoxazin-3-one |
| SMILES | CCN(CC)c1ccc2nc3c(F)c(-c4ccccc4)c(=O)c(F)c-3oc2c1 |
| InChI | InChI=1S/C22H18F2N2O2/c1-3-26(4-2)14-10-11-15-16(12-14)28-22-19(24)21(27)17(18(23)20(22)25-15)13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3 |
| InChIKey | ZVJAYGPAOSPRIN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|