About 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine
5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine (PubChem CID 158082890) has the molecular formula C27H37ClN4O
and a molecular weight of 469.07 g/mol. Its IUPAC name is 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine.
Molecular Properties
| Compound Name | 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine |
| PubChem CID | 158082890 |
| Molecular Formula | C27H37ClN4O |
| Molecular Weight | 469.07 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine |
| SMILES | CCCCc1cncnc1Cl.CCCCc1cncnc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O.C8H11ClN2/c1-5-6-7-16-12-20-14-21-18(16)22-13-15-8-10-17(11-9-15)19(2,3)4;1-2-3-4-7-5-10-6-11-8(7)9/h8-12,14H,5-7,13H2,1-4H3;5-6H,2-4H2,1H3 |
| InChIKey | FNDZYCXCXRXHAN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.07 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine?
The IUPAC name of 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine (CID 158082890) is 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine.
What is the SMILES notation for 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine?
The canonical SMILES for 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine is CCCCc1cncnc1Cl.CCCCc1cncnc1OCc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine?
The InChIKey is FNDZYCXCXRXHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O.C8H11ClN2/c1-5-6-7-16-12-20-14-21-18(16)22-13-15-8-10-17(11-9-15)19(2,3)4;1-2-3-4-7-5-10-6-11-8(7)9/h8-12,14H,5-7,13H2,1-4H3;5-6H,2-4H2,1H3.
What are the key properties of 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine?
5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine has a molecular weight of 469.07 g/mol, XLogP of 7.17, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4-[(4-tert-butylphenyl)methoxy]pyrimidine;5-butyl-4-chloropyrimidine is sourced from PubChem (CID 158082890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).