C24H24BCl3N4O2 — CID 158084876
4-chloro-6-(2,5-dimethylphenyl)pyrimidine;4,6-dichloropyrimidine;(2,5-dimethylphenyl)boronic acid (PubChem CID 158084876) has the molecular formula C24H24BCl3N4O2 and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-chloro-6-(2,5-dimethylphenyl)pyrimidine;4,6-dichloropyrimidine;(2,5-dimethylphenyl)boronic acid.
| Compound Name | 4-chloro-6-(2,5-dimethylphenyl)pyrimidine;4,6-dichloropyrimidine;(2,5-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 158084876 |
| Molecular Formula | C24H24BCl3N4O2 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 4-chloro-6-(2,5-dimethylphenyl)pyrimidine;4,6-dichloropyrimidine;(2,5-dimethylphenyl)boronic acid |
| SMILES | Cc1ccc(C)c(-c2cc(Cl)ncn2)c1.Cc1ccc(C)c(B(O)O)c1.Clc1cc(Cl)ncn1 |
| InChI | InChI=1S/C12H11ClN2.C8H11BO2.C4H2Cl2N2/c1-8-3-4-9(2)10(5-8)11-6-12(13)15-7-14-11;1-6-3-4-7(2)8(5-6)9(10)11;5-3-1-4(6)8-2-7-3/h3-7H,1-2H3;3-5,10-11H,1-2H3;1-2H |
| InChIKey | FNJVQJZRCRBYLK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|