C21H34O4Si — CID 15808504
tert-butyl-[3-(4,4-dimethyl-5-propan-2-yl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenoxy]-dimethylsilane (PubChem CID 15808504) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is tert-butyl-[3-(4,4-dimethyl-5-propan-2-yl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-(4,4-dimethyl-5-propan-2-yl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15808504 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl-[3-(4,4-dimethyl-5-propan-2-yl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenoxy]-dimethylsilane |
| SMILES | CC(C)C12OOC1(c1cccc(O[Si](C)(C)C(C)(C)C)c1)OCC2(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-15(2)20-19(6,7)14-22-21(20,25-24-20)16-11-10-12-17(13-16)23-26(8,9)18(3,4)5/h10-13,15H,14H2,1-9H3 |
| InChIKey | MOKJFSVLZICAIE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|