About (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane
(4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane (PubChem CID 158086549) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane.
Molecular Properties
| Compound Name | (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane |
| PubChem CID | 158086549 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane |
| SMILES | COCC1C(C)C(C)[C@H]1C |
| InChI | InChI=1S/C9H18O/c1-6-7(2)9(5-10-4)8(6)3/h6-9H,5H2,1-4H3/t6?,7-,8?,9?/m1/s1 |
| InChIKey | FNOWGHPSRFORIU-LDIRUYLGSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane?
The IUPAC name of (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane (CID 158086549) is (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane.
What is the SMILES notation for (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane?
The canonical SMILES for (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane is COCC1C(C)C(C)[C@H]1C.
What is the InChIKey of (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane?
The InChIKey is FNOWGHPSRFORIU-LDIRUYLGSA-N. The full InChI is InChI=1S/C9H18O/c1-6-7(2)9(5-10-4)8(6)3/h6-9H,5H2,1-4H3/t6?,7-,8?,9?/m1/s1.
What are the key properties of (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane?
(4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane has a molecular weight of 142.24 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(methoxymethyl)-2,3,4-trimethylcyclobutane is sourced from PubChem (CID 158086549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).