C30H35N7O3S — CID 158088924
formic acid;N-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-2-[(4-pentan-3-ylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 158088924) has the molecular formula C30H35N7O3S and a molecular weight of 573.72 g/mol. Its IUPAC name is formic acid;N-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-2-[(4-pentan-3-ylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | formic acid;N-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-2-[(4-pentan-3-ylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 158088924 |
| Molecular Formula | C30H35N7O3S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | formic acid;N-[6-(1H-indol-4-yl)-1H-indazol-4-yl]-2-[(4-pentan-3-ylpiperazin-1-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(CC)N1CCN(Cc2nc(C(=O)Nc3cc(-c4cccc5[nH]ccc45)cc4[nH]ncc34)cs2)CC1.O=CO |
| InChI | InChI=1S/C29H33N7OS.CH2O2/c1-3-20(4-2)36-12-10-35(11-13-36)17-28-32-27(18-38-28)29(37)33-25-14-19(15-26-23(25)16-31-34-26)21-6-5-7-24-22(21)8-9-30-24;2-1-3/h5-9,14-16,18,20,30H,3-4,10-13,17H2,1-2H3,(H,31,34)(H,33,37);1H,(H,2,3) |
| InChIKey | FNVWLRPOPBIQFW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|