About phenol;1,2,4,5-tetramethylbenzene
phenol;1,2,4,5-tetramethylbenzene (PubChem CID 158089853) has the molecular formula C22H26O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is phenol;1,2,4,5-tetramethylbenzene.
Molecular Properties
| Compound Name | phenol;1,2,4,5-tetramethylbenzene |
| PubChem CID | 158089853 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | phenol;1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)cc1C.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C10H14.2C6H6O/c1-7-5-9(3)10(4)6-8(7)2;2*7-6-4-2-1-3-5-6/h5-6H,1-4H3;2*1-5,7H |
| InChIKey | FNYVBKBCNIUBKN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;1,2,4,5-tetramethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;1,2,4,5-tetramethylbenzene?
The IUPAC name of phenol;1,2,4,5-tetramethylbenzene (CID 158089853) is phenol;1,2,4,5-tetramethylbenzene.
What is the SMILES notation for phenol;1,2,4,5-tetramethylbenzene?
The canonical SMILES for phenol;1,2,4,5-tetramethylbenzene is Cc1cc(C)c(C)cc1C.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;1,2,4,5-tetramethylbenzene?
The InChIKey is FNYVBKBCNIUBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.2C6H6O/c1-7-5-9(3)10(4)6-8(7)2;2*7-6-4-2-1-3-5-6/h5-6H,1-4H3;2*1-5,7H.
What are the key properties of phenol;1,2,4,5-tetramethylbenzene?
phenol;1,2,4,5-tetramethylbenzene has a molecular weight of 322.45 g/mol, XLogP of 5.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;1,2,4,5-tetramethylbenzene is sourced from PubChem (CID 158089853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).