About 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride
1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride (PubChem CID 158090362) has the molecular formula C18H20Cl2N2O2
and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride |
| PubChem CID | 158090362 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride |
| SMILES | CCOc1cc2ncn(Cc3ccc(Cl)cc3)c2cc1OCC.Cl |
| InChI | InChI=1S/C18H19ClN2O2.ClH/c1-3-22-17-9-15-16(10-18(17)23-4-2)21(12-20-15)11-13-5-7-14(19)8-6-13;/h5-10,12H,3-4,11H2,1-2H3;1H |
| InChIKey | FOAJVXMJLCYOJX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride?
The IUPAC name of 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride (CID 158090362) is 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride.
What is the SMILES notation for 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride?
The canonical SMILES for 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride is CCOc1cc2ncn(Cc3ccc(Cl)cc3)c2cc1OCC.Cl.
What is the InChIKey of 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride?
The InChIKey is FOAJVXMJLCYOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O2.ClH/c1-3-22-17-9-15-16(10-18(17)23-4-2)21(12-20-15)11-13-5-7-14(19)8-6-13;/h5-10,12H,3-4,11H2,1-2H3;1H.
What are the key properties of 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride?
1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride has a molecular weight of 367.28 g/mol, XLogP of 4.96, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)methyl]-5,6-diethoxybenzimidazole;hydrochloride is sourced from PubChem (CID 158090362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).