About argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate
argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate (PubChem CID 158091016) has the molecular formula C10H17ArO3S-
and a molecular weight of 257.26 g/mol. Its IUPAC name is argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate.
Molecular Properties
| Compound Name | argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate |
| PubChem CID | 158091016 |
| Molecular Formula | C10H17ArO3S- |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate |
| SMILES | CC1=C(CS(=O)[O-])C(C)(C)CCC1O.[Ar] |
| InChI | InChI=1S/C10H18O3S.Ar/c1-7-8(6-14(12)13)10(2,3)5-4-9(7)11;/h9,11H,4-6H2,1-3H3,(H,12,13);/p-1 |
| InChIKey | UJADCMKOXRGXNE-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The IUPAC name of argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate (CID 158091016) is argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate.
What is the SMILES notation for argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The canonical SMILES for argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate is CC1=C(CS(=O)[O-])C(C)(C)CCC1O.[Ar].
What is the InChIKey of argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The InChIKey is UJADCMKOXRGXNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O3S.Ar/c1-7-8(6-14(12)13)10(2,3)5-4-9(7)11;/h9,11H,4-6H2,1-3H3,(H,12,13);/p-1.
What are the key properties of argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate has a molecular weight of 257.26 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for argon;(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate is sourced from PubChem (CID 158091016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).