About bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine
bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine (PubChem CID 158091084) has the molecular formula C13H11NS5
and a molecular weight of 341.57 g/mol. Its IUPAC name is bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine.
Molecular Properties
| Compound Name | bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine |
| PubChem CID | 158091084 |
| Molecular Formula | C13H11NS5 |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine |
| SMILES | C=Cc1ccc(-c2ccccc2)nc1.S=S=S=S=S |
| InChI | InChI=1S/C13H11N.S5/c1-2-11-8-9-13(14-10-11)12-6-4-3-5-7-12;1-3-5-4-2/h2-10H,1H2; |
| InChIKey | FOCLSYDMIXONAX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine?
The IUPAC name of bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine (CID 158091084) is bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine.
What is the SMILES notation for bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine?
The canonical SMILES for bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine is C=Cc1ccc(-c2ccccc2)nc1.S=S=S=S=S.
What is the InChIKey of bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine?
The InChIKey is FOCLSYDMIXONAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.S5/c1-2-11-8-9-13(14-10-11)12-6-4-3-5-7-12;1-3-5-4-2/h2-10H,1H2;.
What are the key properties of bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine?
bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine has a molecular weight of 341.57 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(sulfanylidene-λ4-sulfanylidene)-λ4-sulfane;5-ethenyl-2-phenylpyridine is sourced from PubChem (CID 158091084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).