C12H22F3NO — CID 158091513
4-[(tert-butylamino)methyl]-1-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 158091513) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-1-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 4-[(tert-butylamino)methyl]-1-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 158091513 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-1-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CC(C)(C)NCC1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-10(2,3)16-8-9-4-6-11(17,7-5-9)12(13,14)15/h9,16-17H,4-8H2,1-3H3 |
| InChIKey | MADAZHIXKQSWLZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |