C6H4Br2O4 — CID 15809266
3,6-dibromobenzene-1,2,4,5-tetrol (PubChem CID 15809266) has the molecular formula C6H4Br2O4 and a molecular weight of 299.90 g/mol. Its IUPAC name is 3,6-dibromobenzene-1,2,4,5-tetrol.
| Compound Name | 3,6-dibromobenzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 15809266 |
| Molecular Formula | C6H4Br2O4 |
| Molecular Weight | 299.90 g/mol |
| Exact Mass | 297.85 |
| IUPAC Name | 3,6-dibromobenzene-1,2,4,5-tetrol |
| SMILES | Oc1c(O)c(Br)c(O)c(O)c1Br |
| InChI | InChI=1S/C6H4Br2O4/c7-1-3(9)5(11)2(8)6(12)4(1)10/h9-12H |
| InChIKey | SQRJJLPELKDQMI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.90 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|