C22H29N3O3 — CID 158095496
methyl (2R)-2-[(8R,9aS)-8-methyl-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-3-cyanopropanoate (PubChem CID 158095496) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl (2R)-2-[(8R,9aS)-8-methyl-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-3-cyanopropanoate.
| Compound Name | methyl (2R)-2-[(8R,9aS)-8-methyl-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-3-cyanopropanoate |
|---|---|
| PubChem CID | 158095496 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl (2R)-2-[(8R,9aS)-8-methyl-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-3-cyanopropanoate |
| SMILES | COC(=O)[C@@H](CC#N)N1CCC(CCc2ccccc2)N2C[C@H](C)C[C@H]2C1=O |
| InChI | InChI=1S/C22H29N3O3/c1-16-14-20-21(26)24(19(10-12-23)22(27)28-2)13-11-18(25(20)15-16)9-8-17-6-4-3-5-7-17/h3-7,16,18-20H,8-11,13-15H2,1-2H3/t16-,18?,19-,20+/m1/s1 |
| InChIKey | XZGLZRZZCSJAAL-VOBGVNJCSA-N |
| XLogP | 2.39 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |