C44H46ClF3N4O4 — CID 158097090
1-(3-chloropropyl)-2-methyl-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide;1-(3-hydroxypropyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid;3-methylaniline (PubChem CID 158097090) has the molecular formula C44H46ClF3N4O4 and a molecular weight of 787.32 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2-methyl-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide;1-(3-hydroxypropyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid;3-methylaniline.
| Compound Name | 1-(3-chloropropyl)-2-methyl-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide;1-(3-hydroxypropyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid;3-methylaniline |
|---|---|
| PubChem CID | 158097090 |
| Molecular Formula | C44H46ClF3N4O4 |
| Molecular Weight | 787.32 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | 1-(3-chloropropyl)-2-methyl-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide;1-(3-hydroxypropyl)-2-methyl-5-phenylpyrrole-3-carboxylic acid;3-methylaniline |
| SMILES | Cc1c(C(=O)Nc2cccc(C(F)(F)F)c2)cc(-c2ccccc2)n1CCCCl.Cc1c(C(=O)O)cc(-c2ccccc2)n1CCCO.Cc1cccc(N)c1 |
| InChI | InChI=1S/C22H20ClF3N2O.C15H17NO3.C7H9N/c1-15-19(21(29)27-18-10-5-9-17(13-18)22(24,25)26)14-20(28(15)12-6-11-23)16-7-3-2-4-8-16;1-11-13(15(18)19)10-14(16(11)8-5-9-17)12-6-3-2-4-7-12;1-6-3-2-4-7(8)5-6/h2-5,7-10,13-14H,6,11-12H2,1H3,(H,27,29);2-4,6-7,10,17H,5,8-9H2,1H3,(H,18,19);2-5H,8H2,1H3 |
| InChIKey | FOUMOPAYKMOBAP-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.32 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|