About carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one
carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one (PubChem CID 158098913) has the molecular formula C27H33NO4
and a molecular weight of 435.56 g/mol. Its IUPAC name is carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one.
Molecular Properties
| Compound Name | carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one |
| PubChem CID | 158098913 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one |
| SMILES | CC(=O)C1CC(N(Cc2ccccc2)Cc2ccccc2)C1.CCC1CC(=O)C1.O=C=O |
| InChI | InChI=1S/C20H23NO.C6H10O.CO2/c1-16(22)19-12-20(13-19)21(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18;1-2-5-3-6(7)4-5;2-1-3/h2-11,19-20H,12-15H2,1H3;5H,2-4H2,1H3; |
| InChIKey | FPAALDUEYJFFBI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one?
The IUPAC name of carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one (CID 158098913) is carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one.
What is the SMILES notation for carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one?
The canonical SMILES for carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one is CC(=O)C1CC(N(Cc2ccccc2)Cc2ccccc2)C1.CCC1CC(=O)C1.O=C=O.
What is the InChIKey of carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one?
The InChIKey is FPAALDUEYJFFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO.C6H10O.CO2/c1-16(22)19-12-20(13-19)21(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18;1-2-5-3-6(7)4-5;2-1-3/h2-11,19-20H,12-15H2,1H3;5H,2-4H2,1H3;.
What are the key properties of carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one?
carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one has a molecular weight of 435.56 g/mol, XLogP of 4.85, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-[3-(dibenzylamino)cyclobutyl]ethanone;3-ethylcyclobutan-1-one is sourced from PubChem (CID 158098913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).