C55H34N6OS — CID 158099162
N-[1-benzothiophen-2-yl(phenyl)methylidene]-8-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-carboximidamide (PubChem CID 158099162) has the molecular formula C55H34N6OS and a molecular weight of 826.99 g/mol. Its IUPAC name is N-[1-benzothiophen-2-yl(phenyl)methylidene]-8-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-carboximidamide.
| Compound Name | N-[1-benzothiophen-2-yl(phenyl)methylidene]-8-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 158099162 |
| Molecular Formula | C55H34N6OS |
| Molecular Weight | 826.99 g/mol |
| Exact Mass | 826.25 |
| IUPAC Name | N-[1-benzothiophen-2-yl(phenyl)methylidene]-8-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(\c1ccccc1)c1cc2ccccc2s1)c1cccc2oc3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)n4)cc3c12 |
| InChI | InChI=1S/C55H34N6OS/c56-52(57-51(34-14-3-1-4-15-34)49-33-37-18-7-12-25-48(37)63-49)42-21-13-24-47-50(42)43-32-38(28-31-46(43)62-47)55-59-53(35-16-5-2-6-17-35)58-54(60-55)36-26-29-39(30-27-36)61-44-22-10-8-19-40(44)41-20-9-11-23-45(41)61/h1-33,56H/b56-52+,57-51+ |
| InChIKey | GCVATKQDABJXLR-ZCKVMPCDSA-N |
| XLogP | 13.95 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.99 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|