About CID 158099431
CID 158099431 (PubChem CID 158099431) has the molecular formula C37H44BN8O4+
and a molecular weight of 675.62 g/mol.
Molecular Properties
| Compound Name | CID 158099431 |
| PubChem CID | 158099431 |
| Molecular Formula | C37H44BN8O4+ |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | — |
| SMILES | [B][N+]1(C2COC2)CCN(c2ccc(Nc3cc(-c4ccnc(N5CCn6c(cc7c6CC(C)(C)C7)C5=O)c4CO)cn(C)c3=O)nc2)[C@@H](C)C1 |
| InChI | InChI=1S/C37H44BN8O4/c1-23-19-46(38,27-21-50-22-27)12-11-43(23)26-5-6-33(40-17-26)41-30-13-25(18-42(4)35(30)48)28-7-8-39-34(29(28)20-47)45-10-9-44-31(36(45)49)14-24-15-37(2,3)16-32(24)44/h5-8,13-14,17-18,23,27,47H,9-12,15-16,19-22H2,1-4H3,(H,40,41)/q+1/t23-,46?/m0/s1 |
| InChIKey | VYQXTLNGUZFDEU-MUOAPGEVSA-N |
| XLogP | 3.17 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158099431 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158099431?
The IUPAC name of CID 158099431 (CID 158099431) is not available.
What is the SMILES notation for CID 158099431?
The canonical SMILES for CID 158099431 is [B][N+]1(C2COC2)CCN(c2ccc(Nc3cc(-c4ccnc(N5CCn6c(cc7c6CC(C)(C)C7)C5=O)c4CO)cn(C)c3=O)nc2)[C@@H](C)C1.
What is the InChIKey of CID 158099431?
The InChIKey is VYQXTLNGUZFDEU-MUOAPGEVSA-N. The full InChI is InChI=1S/C37H44BN8O4/c1-23-19-46(38,27-21-50-22-27)12-11-43(23)26-5-6-33(40-17-26)41-30-13-25(18-42(4)35(30)48)28-7-8-39-34(29(28)20-47)45-10-9-44-31(36(45)49)14-24-15-37(2,3)16-32(24)44/h5-8,13-14,17-18,23,27,47H,9-12,15-16,19-22H2,1-4H3,(H,40,41)/q+1/t23-,46?/m0/s1.
What are the key properties of CID 158099431?
CID 158099431 has a molecular weight of 675.62 g/mol, XLogP of 3.17, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158099431 is sourced from PubChem (CID 158099431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).