About 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine
4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine (PubChem CID 158099733) has the molecular formula C22H16BClF2N4O6
and a molecular weight of 516.65 g/mol. Its IUPAC name is 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine.
Molecular Properties
| Compound Name | 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine |
| PubChem CID | 158099733 |
| Molecular Formula | C22H16BClF2N4O6 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cnccc1-c1ccc(F)cc1.O=[N+]([O-])c1cnccc1Cl.OB(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H7FN2O2.C6H6BFO2.C5H3ClN2O2/c12-9-3-1-8(2-4-9)10-5-6-13-7-11(10)14(15)16;8-6-3-1-5(2-4-6)7(9)10;6-4-1-2-7-3-5(4)8(9)10/h1-7H;1-4,9-10H;1-3H |
| InChIKey | FPCLXLMUOKAJGH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine?
The IUPAC name of 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine (CID 158099733) is 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine.
What is the SMILES notation for 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine?
The canonical SMILES for 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine is O=[N+]([O-])c1cnccc1-c1ccc(F)cc1.O=[N+]([O-])c1cnccc1Cl.OB(O)c1ccc(F)cc1.
What is the InChIKey of 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine?
The InChIKey is FPCLXLMUOKAJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FN2O2.C6H6BFO2.C5H3ClN2O2/c12-9-3-1-8(2-4-9)10-5-6-13-7-11(10)14(15)16;8-6-3-1-5(2-4-6)7(9)10;6-4-1-2-7-3-5(4)8(9)10/h1-7H;1-4,9-10H;1-3H.
What are the key properties of 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine?
4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine has a molecular weight of 516.65 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-nitropyridine;(4-fluorophenyl)boronic acid;4-(4-fluorophenyl)-3-nitropyridine is sourced from PubChem (CID 158099733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).