C8H2F14 — CID 158100137
1,2,3,3,4,4,4-heptafluorobut-1-ene (PubChem CID 158100137) has the molecular formula C8H2F14 and a molecular weight of 364.08 g/mol. Its IUPAC name is 1,2,3,3,4,4,4-heptafluorobut-1-ene.
| Compound Name | 1,2,3,3,4,4,4-heptafluorobut-1-ene |
|---|---|
| PubChem CID | 158100137 |
| Molecular Formula | C8H2F14 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 1,2,3,3,4,4,4-heptafluorobut-1-ene |
| SMILES | FC=C(F)C(F)(F)C(F)(F)F.FC=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C4HF7/c2*5-1-2(6)3(7,8)4(9,10)11/h2*1H |
| InChIKey | FPDROLLPGRXUNL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|