C15H8F6N2O6 — CID 158101511
3,4,5-trifluoro-2-nitrophenol;1,2,3-trifluoro-4-nitro-5-prop-2-enoxybenzene (PubChem CID 158101511) has the molecular formula C15H8F6N2O6 and a molecular weight of 426.23 g/mol. Its IUPAC name is 3,4,5-trifluoro-2-nitrophenol;1,2,3-trifluoro-4-nitro-5-prop-2-enoxybenzene.
| Compound Name | 3,4,5-trifluoro-2-nitrophenol;1,2,3-trifluoro-4-nitro-5-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 158101511 |
| Molecular Formula | C15H8F6N2O6 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 3,4,5-trifluoro-2-nitrophenol;1,2,3-trifluoro-4-nitro-5-prop-2-enoxybenzene |
| SMILES | C=CCOc1cc(F)c(F)c(F)c1[N+](=O)[O-].O=[N+]([O-])c1c(O)cc(F)c(F)c1F |
| InChI | InChI=1S/C9H6F3NO3.C6H2F3NO3/c1-2-3-16-6-4-5(10)7(11)8(12)9(6)13(14)15;7-2-1-3(11)6(10(12)13)5(9)4(2)8/h2,4H,1,3H2;1,11H |
| InChIKey | FPHVYDRGAVSTGP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|