C9H21N3O6S — CID 158101899
2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine;sulfuric acid (PubChem CID 158101899) has the molecular formula C9H21N3O6S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine;sulfuric acid.
| Compound Name | 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine;sulfuric acid |
|---|---|
| PubChem CID | 158101899 |
| Molecular Formula | C9H21N3O6S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine;sulfuric acid |
| SMILES | CCC1(CC)OCC(CN=C(N)N)O1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H19N3O2.H2O4S/c1-3-9(4-2)13-6-7(14-9)5-12-8(10)11;1-5(2,3)4/h7H,3-6H2,1-2H3,(H4,10,11,12);(H2,1,2,3,4) |
| InChIKey | FPJCMAUAIGJHDO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|