About 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine
2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine (PubChem CID 158101900) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine.
Molecular Properties
| Compound Name | 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine |
| PubChem CID | 158101900 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine |
| SMILES | CCC1(CC)OCC(CN=C(N)N)O1 |
| InChI | InChI=1S/C9H19N3O2/c1-3-9(4-2)13-6-7(14-9)5-12-8(10)11/h7H,3-6H2,1-2H3,(H4,10,11,12) |
| InChIKey | RBWLGKXTVVEXAU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine?
The IUPAC name of 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine (CID 158101900) is 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine.
What is the SMILES notation for 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine?
The canonical SMILES for 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine is CCC1(CC)OCC(CN=C(N)N)O1.
What is the InChIKey of 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine?
The InChIKey is RBWLGKXTVVEXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-3-9(4-2)13-6-7(14-9)5-12-8(10)11/h7H,3-6H2,1-2H3,(H4,10,11,12).
What are the key properties of 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine?
2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine has a molecular weight of 201.27 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]guanidine is sourced from PubChem (CID 158101900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).