C11H18O8 — CID 158102004
2,2-diacetyl-3-oxobutanoic acid;propane-1,2,3-triol (PubChem CID 158102004) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2,2-diacetyl-3-oxobutanoic acid;propane-1,2,3-triol.
| Compound Name | 2,2-diacetyl-3-oxobutanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 158102004 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2,2-diacetyl-3-oxobutanoic acid;propane-1,2,3-triol |
| SMILES | CC(=O)C(C(C)=O)(C(C)=O)C(=O)O.OCC(O)CO |
| InChI | InChI=1S/C8H10O5.C3H8O3/c1-4(9)8(5(2)10,6(3)11)7(12)13;4-1-3(6)2-5/h1-3H3,(H,12,13);3-6H,1-2H2 |
| InChIKey | FPJLAVJOOILQSE-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|