C15H20O5 — CID 158103721
(1S,2S,4S,5R,6S,7R)-5-(methoxymethoxy)-1,4-dimethylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,8-dione (PubChem CID 158103721) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1S,2S,4S,5R,6S,7R)-5-(methoxymethoxy)-1,4-dimethylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,8-dione.
| Compound Name | (1S,2S,4S,5R,6S,7R)-5-(methoxymethoxy)-1,4-dimethylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,8-dione |
|---|---|
| PubChem CID | 158103721 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1S,2S,4S,5R,6S,7R)-5-(methoxymethoxy)-1,4-dimethylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,8-dione |
| SMILES | COCO[C@@H]1[C@H]2[C@H]3O[C@@](C)([C@H]2C(=O)[C@H]1C)C1(CC1)C3=O |
| InChI | InChI=1S/C15H20O5/c1-7-10(16)9-8(11(7)19-6-18-3)12-13(17)15(4-5-15)14(9,2)20-12/h7-9,11-12H,4-6H2,1-3H3/t7-,8+,9-,11+,12-,14+/m1/s1 |
| InChIKey | FPOQFRHRGQKFRN-VXMUHBDESA-N |
| XLogP | 0.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|