C17H32NO+ — CID 158103961
3,3-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)butan-2-one (PubChem CID 158103961) has the molecular formula C17H32NO+ and a molecular weight of 266.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)butan-2-one |
|---|---|
| PubChem CID | 158103961 |
| Molecular Formula | C17H32NO+ |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | 3,3-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)butan-2-one |
| SMILES | CC(C)[N+]1(C)C2CCC1CC(CC(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C17H32NO/c1-12(2)18(6)14-7-8-15(18)10-13(9-14)11-16(19)17(3,4)5/h12-15H,7-11H2,1-6H3/q+1 |
| InChIKey | TXJKIYUYYGQMBF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|