C18H32NO2+ — CID 158103962
4,4-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)pentane-2,3-dione (PubChem CID 158103962) has the molecular formula C18H32NO2+ and a molecular weight of 294.46 g/mol. Its IUPAC name is 4,4-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)pentane-2,3-dione.
| Compound Name | 4,4-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)pentane-2,3-dione |
|---|---|
| PubChem CID | 158103962 |
| Molecular Formula | C18H32NO2+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 4,4-dimethyl-1-(8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl)pentane-2,3-dione |
| SMILES | CC(C)[N+]1(C)C2CCC1CC(CC(=O)C(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C18H32NO2/c1-12(2)19(6)14-7-8-15(19)10-13(9-14)11-16(20)17(21)18(3,4)5/h12-15H,7-11H2,1-6H3/q+1 |
| InChIKey | BLXJGZUXQZUFNB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|