About 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane
2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane (PubChem CID 158104319) has the molecular formula C18H27NO4S
and a molecular weight of 353.48 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane |
| PubChem CID | 158104319 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane |
| SMILES | CC.C[C@@H]1C(CC(C)(C)C(=O)O)=Cc2ccccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C16H21NO4S.C2H6/c1-11-13(10-16(2,3)15(18)19)9-12-7-5-6-8-14(12)17(11)22(4,20)21;1-2/h5-9,11H,10H2,1-4H3,(H,18,19);1-2H3/t11-;/m1./s1 |
| InChIKey | FPQMRHDMIMXFML-RFVHGSKJSA-N |
| XLogP | 3.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane?
The IUPAC name of 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane (CID 158104319) is 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane.
What is the SMILES notation for 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane?
The canonical SMILES for 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane is CC.C[C@@H]1C(CC(C)(C)C(=O)O)=Cc2ccccc2N1S(C)(=O)=O.
What is the InChIKey of 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane?
The InChIKey is FPQMRHDMIMXFML-RFVHGSKJSA-N. The full InChI is InChI=1S/C16H21NO4S.C2H6/c1-11-13(10-16(2,3)15(18)19)9-12-7-5-6-8-14(12)17(11)22(4,20)21;1-2/h5-9,11H,10H2,1-4H3,(H,18,19);1-2H3/t11-;/m1./s1.
What are the key properties of 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane?
2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane has a molecular weight of 353.48 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[(2R)-2-methyl-1-methylsulfonyl-2H-quinolin-3-yl]propanoic acid;ethane is sourced from PubChem (CID 158104319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).