About 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone
5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone (PubChem CID 158105283) has the molecular formula C16H10BrF3N6O2
and a molecular weight of 455.19 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone |
| PubChem CID | 158105283 |
| Molecular Formula | C16H10BrF3N6O2 |
| Molecular Weight | 455.19 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone |
| SMILES | FC(F)(F)c1noc(-c2ccc(Br)cc2)n1.O=C(n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C9H4BrF3N2O.C7H6N4O/c10-6-3-1-5(2-4-6)7-14-8(15-16-7)9(11,12)13;12-7(10-3-1-8-5-10)11-4-2-9-6-11/h1-4H;1-6H |
| InChIKey | FPTGCTFJAPNYBC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone?
The IUPAC name of 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone (CID 158105283) is 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone.
What is the SMILES notation for 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone?
The canonical SMILES for 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone is FC(F)(F)c1noc(-c2ccc(Br)cc2)n1.O=C(n1ccnc1)n1ccnc1.
What is the InChIKey of 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone?
The InChIKey is FPTGCTFJAPNYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrF3N2O.C7H6N4O/c10-6-3-1-5(2-4-6)7-14-8(15-16-7)9(11,12)13;12-7(10-3-1-8-5-10)11-4-2-9-6-11/h1-4H;1-6H.
What are the key properties of 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone?
5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone has a molecular weight of 455.19 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-3-(trifluoromethyl)-1,2,4-oxadiazole;di(imidazol-1-yl)methanone is sourced from PubChem (CID 158105283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).