About 5-(3,5-dichlorophenyl)pentan-1-amine
5-(3,5-dichlorophenyl)pentan-1-amine (PubChem CID 158105939) has the molecular formula C11H15Cl2N
and a molecular weight of 232.15 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)pentan-1-amine |
| PubChem CID | 158105939 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-(3,5-dichlorophenyl)pentan-1-amine |
| SMILES | NCCCCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N/c12-10-6-9(7-11(13)8-10)4-2-1-3-5-14/h6-8H,1-5,14H2 |
| InChIKey | FPVGYGDDZJGNFI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichlorophenyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)pentan-1-amine?
The IUPAC name of 5-(3,5-dichlorophenyl)pentan-1-amine (CID 158105939) is 5-(3,5-dichlorophenyl)pentan-1-amine.
What is the SMILES notation for 5-(3,5-dichlorophenyl)pentan-1-amine?
The canonical SMILES for 5-(3,5-dichlorophenyl)pentan-1-amine is NCCCCCc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-(3,5-dichlorophenyl)pentan-1-amine?
The InChIKey is FPVGYGDDZJGNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N/c12-10-6-9(7-11(13)8-10)4-2-1-3-5-14/h6-8H,1-5,14H2.
What are the key properties of 5-(3,5-dichlorophenyl)pentan-1-amine?
5-(3,5-dichlorophenyl)pentan-1-amine has a molecular weight of 232.15 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)pentan-1-amine is sourced from PubChem (CID 158105939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).