About N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride
N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride (PubChem CID 158106364) has the molecular formula C15H19ClN2
and a molecular weight of 262.78 g/mol. Its IUPAC name is N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride |
| PubChem CID | 158106364 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride |
| SMILES | C/N=C(/Cc1ccc2ccc(C)cc2c1)NC.Cl |
| InChI | InChI=1S/C15H18N2.ClH/c1-11-4-6-13-7-5-12(9-14(13)8-11)10-15(16-2)17-3;/h4-9H,10H2,1-3H3,(H,16,17);1H |
| InChIKey | FPWQUPXKJAGIKH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride?
The IUPAC name of N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride (CID 158106364) is N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride.
What is the SMILES notation for N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride?
The canonical SMILES for N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride is C/N=C(/Cc1ccc2ccc(C)cc2c1)NC.Cl.
What is the InChIKey of N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride?
The InChIKey is FPWQUPXKJAGIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.ClH/c1-11-4-6-13-7-5-12(9-14(13)8-11)10-15(16-2)17-3;/h4-9H,10H2,1-3H3,(H,16,17);1H.
What are the key properties of N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride?
N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride has a molecular weight of 262.78 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-2-(7-methylnaphthalen-2-yl)ethanimidamide;hydrochloride is sourced from PubChem (CID 158106364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).