C34H44N2 — CID 158107092
4-[1-(4-anilino-1,3,5,6-tetramethylcyclohexa-2,4-dien-1-yl)ethyl]-2,3,4,6-tetramethyl-N-phenylcyclohexa-1,5-dien-1-amine (PubChem CID 158107092) has the molecular formula C34H44N2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 4-[1-(4-anilino-1,3,5,6-tetramethylcyclohexa-2,4-dien-1-yl)ethyl]-2,3,4,6-tetramethyl-N-phenylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-[1-(4-anilino-1,3,5,6-tetramethylcyclohexa-2,4-dien-1-yl)ethyl]-2,3,4,6-tetramethyl-N-phenylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 158107092 |
| Molecular Formula | C34H44N2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 4-[1-(4-anilino-1,3,5,6-tetramethylcyclohexa-2,4-dien-1-yl)ethyl]-2,3,4,6-tetramethyl-N-phenylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=CC(C)(C(C)C2(C)C=C(C)C(Nc3ccccc3)=C(C)C2C)C(C)C(C)=C1Nc1ccccc1 |
| InChI | InChI=1S/C34H44N2/c1-22-20-33(8,26(5)24(3)31(22)35-29-16-12-10-13-17-29)28(7)34(9)21-23(2)32(25(4)27(34)6)36-30-18-14-11-15-19-30/h10-21,26-28,35-36H,1-9H3 |
| InChIKey | FPYVPCOOBZVREO-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |